2,6-bis(4-methylphenyl)benzo[1,2-d:4,5-d']bis[1,3]thiazole
Chemical Structure Depiction of
2,6-bis(4-methylphenyl)benzo[1,2-d:4,5-d']bis[1,3]thiazole
2,6-bis(4-methylphenyl)benzo[1,2-d:4,5-d']bis[1,3]thiazole
Compound characteristics
| Compound ID: | 6844-3306 |
| Compound Name: | 2,6-bis(4-methylphenyl)benzo[1,2-d:4,5-d']bis[1,3]thiazole |
| Molecular Weight: | 372.51 |
| Molecular Formula: | C22 H16 N2 S2 |
| Smiles: | Cc1ccc(cc1)c1nc2cc3c(cc2s1)nc(c1ccc(C)cc1)s3 |
| Stereo: | ACHIRAL |
| logP: | 7.1529 |
| logD: | 7.1529 |
| logSw: | -5.8596 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 19.1362 |
| InChI Key: | UKRUDQQIXJTMRF-UHFFFAOYSA-N |