N-[5-(4-tert-butylphenyl)-1,2,4-thiadiazol-3-yl]-2-{[5-(4-chlorophenyl)[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]sulfanyl}acetamide
Chemical Structure Depiction of
N-[5-(4-tert-butylphenyl)-1,2,4-thiadiazol-3-yl]-2-{[5-(4-chlorophenyl)[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]sulfanyl}acetamide
N-[5-(4-tert-butylphenyl)-1,2,4-thiadiazol-3-yl]-2-{[5-(4-chlorophenyl)[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | 6850-0292 |
| Compound Name: | N-[5-(4-tert-butylphenyl)-1,2,4-thiadiazol-3-yl]-2-{[5-(4-chlorophenyl)[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]sulfanyl}acetamide |
| Molecular Weight: | 541.11 |
| Molecular Formula: | C24 H21 Cl N6 O S3 |
| Smiles: | CC(C)(C)c1ccc(cc1)c1nc(NC(CSc2nnc3n2c(cs3)c2ccc(cc2)[Cl])=O)ns1 |
| Stereo: | ACHIRAL |
| logP: | 7.3449 |
| logD: | 7.3449 |
| logSw: | -6.4839 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.616 |
| InChI Key: | YQLRXHSRKAPOAM-UHFFFAOYSA-N |