3-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-2-ethoxy-6-methylpyridine
Chemical Structure Depiction of
3-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-2-ethoxy-6-methylpyridine
3-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-2-ethoxy-6-methylpyridine
Compound characteristics
| Compound ID: | 6917-0316 |
| Compound Name: | 3-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-2-ethoxy-6-methylpyridine |
| Molecular Weight: | 315.76 |
| Molecular Formula: | C16 H14 Cl N3 O2 |
| Smiles: | CCOc1c(ccc(C)n1)c1nc(c2ccccc2[Cl])on1 |
| Stereo: | ACHIRAL |
| logP: | 4.7658 |
| logD: | 4.7652 |
| logSw: | -4.8906 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 47.947 |
| InChI Key: | DLXALVRVZFBASU-UHFFFAOYSA-N |