2-ethoxy-3-[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]-6-(4-methylphenyl)pyridine
Chemical Structure Depiction of
2-ethoxy-3-[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]-6-(4-methylphenyl)pyridine
2-ethoxy-3-[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]-6-(4-methylphenyl)pyridine
Compound characteristics
| Compound ID: | 6917-0403 |
| Compound Name: | 2-ethoxy-3-[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]-6-(4-methylphenyl)pyridine |
| Molecular Weight: | 347.37 |
| Molecular Formula: | C20 H17 N3 O3 |
| Smiles: | CCOc1c(ccc(c2ccc(C)cc2)n1)c1nc(c2ccco2)on1 |
| Stereo: | ACHIRAL |
| logP: | 5.4889 |
| logD: | 5.486 |
| logSw: | -5.5729 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 56.448 |
| InChI Key: | XEHIRVWXNSBROG-UHFFFAOYSA-N |