2-[3-(cyclohexanecarbonyl)-1H-indol-1-yl]-N-(4-methylphenyl)acetamide
Chemical Structure Depiction of
2-[3-(cyclohexanecarbonyl)-1H-indol-1-yl]-N-(4-methylphenyl)acetamide
2-[3-(cyclohexanecarbonyl)-1H-indol-1-yl]-N-(4-methylphenyl)acetamide
Compound characteristics
| Compound ID: | 6948-4456 |
| Compound Name: | 2-[3-(cyclohexanecarbonyl)-1H-indol-1-yl]-N-(4-methylphenyl)acetamide |
| Molecular Weight: | 374.48 |
| Molecular Formula: | C24 H26 N2 O2 |
| Smiles: | Cc1ccc(cc1)NC(Cn1cc(C(C2CCCCC2)=O)c2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5515 |
| logD: | 5.5515 |
| logSw: | -5.4092 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.779 |
| InChI Key: | ILHKQPNRXZKORX-UHFFFAOYSA-N |