{1-[(4-chlorophenyl)methyl]-1H-indol-3-yl}(furan-2-yl)methanone
Chemical Structure Depiction of
{1-[(4-chlorophenyl)methyl]-1H-indol-3-yl}(furan-2-yl)methanone
{1-[(4-chlorophenyl)methyl]-1H-indol-3-yl}(furan-2-yl)methanone
Compound characteristics
| Compound ID: | 6948-4586 |
| Compound Name: | {1-[(4-chlorophenyl)methyl]-1H-indol-3-yl}(furan-2-yl)methanone |
| Molecular Weight: | 335.79 |
| Molecular Formula: | C20 H14 Cl N O2 |
| Smiles: | C(c1ccc(cc1)[Cl])n1cc(C(c2ccco2)=O)c2ccccc12 |
| Stereo: | ACHIRAL |
| logP: | 4.8094 |
| logD: | 4.8094 |
| logSw: | -5.1047 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 24.016 |
| InChI Key: | IKRFCLVDCGHBLJ-UHFFFAOYSA-N |