1-(3-ethoxy-4-hydroxyphenyl)-7-fluoro-2-[(4-fluorophenyl)methyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Chemical Structure Depiction of
1-(3-ethoxy-4-hydroxyphenyl)-7-fluoro-2-[(4-fluorophenyl)methyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
1-(3-ethoxy-4-hydroxyphenyl)-7-fluoro-2-[(4-fluorophenyl)methyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Compound characteristics
| Compound ID: | 6959-1115 |
| Compound Name: | 1-(3-ethoxy-4-hydroxyphenyl)-7-fluoro-2-[(4-fluorophenyl)methyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione |
| Molecular Weight: | 463.44 |
| Molecular Formula: | C26 H19 F2 N O5 |
| Smiles: | CCOc1cc(ccc1O)C1C2=C(C(N1Cc1ccc(cc1)F)=O)Oc1ccc(cc1C2=O)F |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2923 |
| logD: | 4.291 |
| logSw: | -3.9996 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.491 |
| InChI Key: | JGCBXTWIZOBONX-HSZRJFAPSA-N |