7-fluoro-1-(3-hydroxyphenyl)-2-[(4-methylphenyl)methyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Chemical Structure Depiction of
7-fluoro-1-(3-hydroxyphenyl)-2-[(4-methylphenyl)methyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
7-fluoro-1-(3-hydroxyphenyl)-2-[(4-methylphenyl)methyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Compound characteristics
| Compound ID: | 6959-1215 |
| Compound Name: | 7-fluoro-1-(3-hydroxyphenyl)-2-[(4-methylphenyl)methyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione |
| Molecular Weight: | 415.42 |
| Molecular Formula: | C25 H18 F N O4 |
| Smiles: | Cc1ccc(CN2C(C3=C(C2=O)Oc2ccc(cc2C3=O)F)c2cccc(c2)O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.485 |
| logD: | 4.4727 |
| logSw: | -4.2042 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.35 |
| InChI Key: | QGNNASAUWHBAJT-JOCHJYFZSA-N |