2-(thiophen-2-yl)-5-(2,3,4-trimethoxyphenyl)-1,10b-dihydro-5H-pyrazolo[1,5-c][1,3]benzoxazine
Chemical Structure Depiction of
2-(thiophen-2-yl)-5-(2,3,4-trimethoxyphenyl)-1,10b-dihydro-5H-pyrazolo[1,5-c][1,3]benzoxazine
2-(thiophen-2-yl)-5-(2,3,4-trimethoxyphenyl)-1,10b-dihydro-5H-pyrazolo[1,5-c][1,3]benzoxazine
Compound characteristics
| Compound ID: | 6969-1560 |
| Compound Name: | 2-(thiophen-2-yl)-5-(2,3,4-trimethoxyphenyl)-1,10b-dihydro-5H-pyrazolo[1,5-c][1,3]benzoxazine |
| Molecular Weight: | 422.5 |
| Molecular Formula: | C23 H22 N2 O4 S |
| Smiles: | COc1ccc(C2N3C(CC(c4cccs4)=N3)c3ccccc3O2)c(c1OC)OC |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.0054 |
| logD: | 5.0054 |
| logSw: | -4.71 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 46.129 |
| InChI Key: | OYTRLFILHQEVSF-UHFFFAOYSA-N |