3-(4-tert-butylphenyl)-6-(2-phenylethyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Chemical Structure Depiction of
3-(4-tert-butylphenyl)-6-(2-phenylethyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
3-(4-tert-butylphenyl)-6-(2-phenylethyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Compound characteristics
| Compound ID: | 7009-0275 |
| Compound Name: | 3-(4-tert-butylphenyl)-6-(2-phenylethyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| Molecular Weight: | 362.5 |
| Molecular Formula: | C21 H22 N4 S |
| Smiles: | CC(C)(C)c1ccc(cc1)c1nnc2n1nc(CCc1ccccc1)s2 |
| Stereo: | ACHIRAL |
| logP: | 5.9546 |
| logD: | 5.9546 |
| logSw: | -5.8038 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 34.217 |
| InChI Key: | OWOAMUDLZZUJHK-UHFFFAOYSA-N |