ethyl 4-{[(2,4-dioxo-2H-1-benzopyran-3(4H)-ylidene)methyl]amino}benzoate
Chemical Structure Depiction of
ethyl 4-{[(2,4-dioxo-2H-1-benzopyran-3(4H)-ylidene)methyl]amino}benzoate
ethyl 4-{[(2,4-dioxo-2H-1-benzopyran-3(4H)-ylidene)methyl]amino}benzoate
Compound characteristics
| Compound ID: | 7009-0720 |
| Compound Name: | ethyl 4-{[(2,4-dioxo-2H-1-benzopyran-3(4H)-ylidene)methyl]amino}benzoate |
| Molecular Weight: | 337.33 |
| Molecular Formula: | C19 H15 N O5 |
| Smiles: | CCOC(c1ccc(cc1)N/C=C1/C(c2ccccc2OC1=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4155 |
| logD: | 3.4099 |
| logSw: | -3.7668 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.39 |
| InChI Key: | BAMACWLEFMHVGS-UHFFFAOYSA-N |