3-(hexylsulfanyl)[1,2,4]triazino[5,6-d][3,1]benzoxazepine
Chemical Structure Depiction of
3-(hexylsulfanyl)[1,2,4]triazino[5,6-d][3,1]benzoxazepine
3-(hexylsulfanyl)[1,2,4]triazino[5,6-d][3,1]benzoxazepine
Compound characteristics
| Compound ID: | 7033-0596 |
| Compound Name: | 3-(hexylsulfanyl)[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| Molecular Weight: | 314.41 |
| Molecular Formula: | C16 H18 N4 O S |
| Smiles: | CCCCCCSc1nc2c(c3ccccc3N=CO2)nn1 |
| Stereo: | ACHIRAL |
| logP: | 4.3279 |
| logD: | 4.3279 |
| logSw: | -4.4917 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 50.281 |
| InChI Key: | ORFKCRDNLKSEIW-UHFFFAOYSA-N |