3-[5-(3-methoxyphenyl)-1,2,4-oxadiazol-3-yl]-7-methylquinolin-2-ol
Chemical Structure Depiction of
3-[5-(3-methoxyphenyl)-1,2,4-oxadiazol-3-yl]-7-methylquinolin-2-ol
3-[5-(3-methoxyphenyl)-1,2,4-oxadiazol-3-yl]-7-methylquinolin-2-ol
Compound characteristics
| Compound ID: | 7062-0614 |
| Compound Name: | 3-[5-(3-methoxyphenyl)-1,2,4-oxadiazol-3-yl]-7-methylquinolin-2-ol |
| Molecular Weight: | 333.34 |
| Molecular Formula: | C19 H15 N3 O3 |
| Smiles: | Cc1ccc2cc(c(nc2c1)O)c1nc(c2cccc(c2)OC)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.3389 |
| logD: | 3.5566 |
| logSw: | -4.5552 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.479 |
| InChI Key: | OMPKCPTVMUUVTP-UHFFFAOYSA-N |