4-amino-N-(2-{[(4-chlorophenyl)methyl]amino}ethyl)-1,2,5-oxadiazole-3-carboxamide
Chemical Structure Depiction of
4-amino-N-(2-{[(4-chlorophenyl)methyl]amino}ethyl)-1,2,5-oxadiazole-3-carboxamide
4-amino-N-(2-{[(4-chlorophenyl)methyl]amino}ethyl)-1,2,5-oxadiazole-3-carboxamide
Compound characteristics
| Compound ID: | 7092-1236 |
| Compound Name: | 4-amino-N-(2-{[(4-chlorophenyl)methyl]amino}ethyl)-1,2,5-oxadiazole-3-carboxamide |
| Molecular Weight: | 295.73 |
| Molecular Formula: | C12 H14 Cl N5 O2 |
| Smiles: | [H]N(CCNC(c1c(N)non1)=O)Cc1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 0.871 |
| logD: | 0.295 |
| logSw: | -2.3299 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 93.457 |
| InChI Key: | LDGMYGVYQCEUHE-UHFFFAOYSA-N |