N-(3,4-dimethylphenyl)-4-(pyridin-3-yl)-1,3-thiazol-2-amine
Chemical Structure Depiction of
N-(3,4-dimethylphenyl)-4-(pyridin-3-yl)-1,3-thiazol-2-amine
N-(3,4-dimethylphenyl)-4-(pyridin-3-yl)-1,3-thiazol-2-amine
Compound characteristics
| Compound ID: | 7100-1138 |
| Compound Name: | N-(3,4-dimethylphenyl)-4-(pyridin-3-yl)-1,3-thiazol-2-amine |
| Molecular Weight: | 281.38 |
| Molecular Formula: | C16 H15 N3 S |
| Smiles: | Cc1ccc(cc1C)Nc1nc(cs1)c1cccnc1 |
| Stereo: | ACHIRAL |
| logP: | 4.7946 |
| logD: | 4.7719 |
| logSw: | -4.3449 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 28.4435 |
| InChI Key: | YYQJMUZUTIQOHV-UHFFFAOYSA-N |