5-bromo-N-[4-(3-methyl[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]furan-2-carboxamide
Chemical Structure Depiction of
5-bromo-N-[4-(3-methyl[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]furan-2-carboxamide
5-bromo-N-[4-(3-methyl[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | 7139-8037 |
| Compound Name: | 5-bromo-N-[4-(3-methyl[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]furan-2-carboxamide |
| Molecular Weight: | 404.24 |
| Molecular Formula: | C15 H10 Br N5 O2 S |
| Smiles: | Cc1nnc2n1nc(c1ccc(cc1)NC(c1ccc(o1)[Br])=O)s2 |
| Stereo: | ACHIRAL |
| logP: | 2.6417 |
| logD: | 2.6411 |
| logSw: | -3.2382 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.787 |
| InChI Key: | RPWMXGMQQOXZKI-UHFFFAOYSA-N |