2,9-dimethyl-5-(3-methylthiophen-2-yl)-5,6-dihydropyrazolo[1,5-c]quinazoline
Chemical Structure Depiction of
2,9-dimethyl-5-(3-methylthiophen-2-yl)-5,6-dihydropyrazolo[1,5-c]quinazoline
2,9-dimethyl-5-(3-methylthiophen-2-yl)-5,6-dihydropyrazolo[1,5-c]quinazoline
Compound characteristics
| Compound ID: | 7210-2080 |
| Compound Name: | 2,9-dimethyl-5-(3-methylthiophen-2-yl)-5,6-dihydropyrazolo[1,5-c]quinazoline |
| Molecular Weight: | 295.4 |
| Molecular Formula: | C17 H17 N3 S |
| Smiles: | Cc1ccc2c(c1)c1cc(C)nn1C(c1c(C)ccs1)N2 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.016 |
| logD: | 4.016 |
| logSw: | -4.1094 |
| Hydrogen bond acceptors count: | 1 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 25.3492 |
| InChI Key: | RWQHEWFWLKRKOL-KRWDZBQOSA-N |