6-[5-(3,5-dichlorophenyl)furan-2-yl]-3-(furan-2-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine
Chemical Structure Depiction of
6-[5-(3,5-dichlorophenyl)furan-2-yl]-3-(furan-2-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine
6-[5-(3,5-dichlorophenyl)furan-2-yl]-3-(furan-2-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine
Compound characteristics
| Compound ID: | 7258-0934 |
| Compound Name: | 6-[5-(3,5-dichlorophenyl)furan-2-yl]-3-(furan-2-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| Molecular Weight: | 417.27 |
| Molecular Formula: | C18 H10 Cl2 N4 O2 S |
| Smiles: | C1C(c2ccc(c3cc(cc(c3)[Cl])[Cl])o2)=Nn2c(c3ccco3)nnc2S1 |
| Stereo: | ACHIRAL |
| logP: | 5.3262 |
| logD: | 5.3168 |
| logSw: | -6.1336 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 50.936 |
| InChI Key: | PGGBIDZFHQVDQG-UHFFFAOYSA-N |