2-(2-{[(3-oxo-1-benzothiophen-2(3H)-ylidene)methyl]amino}phenyl)-4H-3,1-benzoxazin-4-one
Chemical Structure Depiction of
2-(2-{[(3-oxo-1-benzothiophen-2(3H)-ylidene)methyl]amino}phenyl)-4H-3,1-benzoxazin-4-one
2-(2-{[(3-oxo-1-benzothiophen-2(3H)-ylidene)methyl]amino}phenyl)-4H-3,1-benzoxazin-4-one
Compound characteristics
| Compound ID: | 7265-2369 |
| Compound Name: | 2-(2-{[(3-oxo-1-benzothiophen-2(3H)-ylidene)methyl]amino}phenyl)-4H-3,1-benzoxazin-4-one |
| Molecular Weight: | 398.44 |
| Molecular Formula: | C23 H14 N2 O3 S |
| Smiles: | C(=C1/C(c2ccccc2S1)=O)\Nc1ccccc1C1=Nc2ccccc2C(=O)O1 |
| Stereo: | ACHIRAL |
| logP: | 4.0861 |
| logD: | 4.0861 |
| logSw: | -4.4818 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.25 |
| InChI Key: | ASTXSGGIULTKBN-UHFFFAOYSA-N |