N-[2-(dimethylamino)ethyl]-2-oxo-2H-1-benzopyran-3-carboxamide
Chemical Structure Depiction of
N-[2-(dimethylamino)ethyl]-2-oxo-2H-1-benzopyran-3-carboxamide
N-[2-(dimethylamino)ethyl]-2-oxo-2H-1-benzopyran-3-carboxamide
Compound characteristics
| Compound ID: | 7265-2639 |
| Compound Name: | N-[2-(dimethylamino)ethyl]-2-oxo-2H-1-benzopyran-3-carboxamide |
| Molecular Weight: | 260.29 |
| Molecular Formula: | C14 H16 N2 O3 |
| Smiles: | CN(C)CCNC(C1=Cc2ccccc2OC1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.7827 |
| logD: | -0.9503 |
| logSw: | -1.8384 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.552 |
| InChI Key: | ISZMBNDDWQZMTM-UHFFFAOYSA-N |