methyl 5-[N-(4-fluoro-2-methylbenzene-1-sulfonyl)-4-methylbenzamido]-2-methyl-1-benzofuran-3-carboxylate
Chemical Structure Depiction of
methyl 5-[N-(4-fluoro-2-methylbenzene-1-sulfonyl)-4-methylbenzamido]-2-methyl-1-benzofuran-3-carboxylate
methyl 5-[N-(4-fluoro-2-methylbenzene-1-sulfonyl)-4-methylbenzamido]-2-methyl-1-benzofuran-3-carboxylate
Compound characteristics
| Compound ID: | 7287-0158 |
| Compound Name: | methyl 5-[N-(4-fluoro-2-methylbenzene-1-sulfonyl)-4-methylbenzamido]-2-methyl-1-benzofuran-3-carboxylate |
| Molecular Weight: | 495.53 |
| Molecular Formula: | C26 H22 F N O6 S |
| Smiles: | Cc1ccc(cc1)C(N(c1ccc2c(c1)c(C(=O)OC)c(C)o2)S(c1ccc(cc1C)F)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3035 |
| logD: | 5.3035 |
| logSw: | -5.5501 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 74.667 |
| InChI Key: | AVBNLANSRHHGPY-UHFFFAOYSA-N |