4-methyl-1-[4-(4-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)-1,3-oxazol-5-yl]piperidine
Chemical Structure Depiction of
4-methyl-1-[4-(4-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)-1,3-oxazol-5-yl]piperidine
4-methyl-1-[4-(4-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)-1,3-oxazol-5-yl]piperidine
Compound characteristics
| Compound ID: | 7294-0835 |
| Compound Name: | 4-methyl-1-[4-(4-methylbenzene-1-sulfonyl)-2-(thiophen-2-yl)-1,3-oxazol-5-yl]piperidine |
| Molecular Weight: | 402.53 |
| Molecular Formula: | C20 H22 N2 O3 S2 |
| Smiles: | CC1CCN(CC1)c1c(nc(c2cccs2)o1)S(c1ccc(C)cc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2255 |
| logD: | 5.2255 |
| logSw: | -5.1418 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 52.497 |
| InChI Key: | YZWYVJXOLNQYAA-UHFFFAOYSA-N |