N-[3-(5-bromo-2-chlorobenzamido)-4-methoxyphenyl]furan-2-carboxamide
Chemical Structure Depiction of
N-[3-(5-bromo-2-chlorobenzamido)-4-methoxyphenyl]furan-2-carboxamide
N-[3-(5-bromo-2-chlorobenzamido)-4-methoxyphenyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | 7397-0086 |
| Compound Name: | N-[3-(5-bromo-2-chlorobenzamido)-4-methoxyphenyl]furan-2-carboxamide |
| Molecular Weight: | 449.69 |
| Molecular Formula: | C19 H14 Br Cl N2 O4 |
| Smiles: | COc1ccc(cc1NC(c1cc(ccc1[Cl])[Br])=O)NC(c1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5079 |
| logD: | 4.3825 |
| logSw: | -4.6218 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 61.932 |
| InChI Key: | AHFYQTZUWQSAOS-UHFFFAOYSA-N |