N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]-2,4-dimethylbenzamide
Chemical Structure Depiction of
N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]-2,4-dimethylbenzamide
N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]-2,4-dimethylbenzamide
Compound characteristics
| Compound ID: | 7418-0601 |
| Compound Name: | N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]-2,4-dimethylbenzamide |
| Molecular Weight: | 384.48 |
| Molecular Formula: | C25 H24 N2 O2 |
| Smiles: | Cc1ccc(C(Nc2cccc(c2C)c2nc3cc(C)cc(C)c3o2)=O)c(C)c1 |
| Stereo: | ACHIRAL |
| logP: | 6.4113 |
| logD: | 6.4112 |
| logSw: | -5.6133 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.675 |
| InChI Key: | GCLLJIKLWBXVFY-UHFFFAOYSA-N |