N-(1,3-benzothiazol-2-yl)-2-{[5-(2-hydroxyphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}acetamide
Chemical Structure Depiction of
N-(1,3-benzothiazol-2-yl)-2-{[5-(2-hydroxyphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}acetamide
N-(1,3-benzothiazol-2-yl)-2-{[5-(2-hydroxyphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | 7445-0090 |
| Compound Name: | N-(1,3-benzothiazol-2-yl)-2-{[5-(2-hydroxyphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}acetamide |
| Molecular Weight: | 459.55 |
| Molecular Formula: | C23 H17 N5 O2 S2 |
| Smiles: | C(C(Nc1nc2ccccc2s1)=O)Sc1nnc(c2ccccc2O)n1c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.4526 |
| logD: | 5.1908 |
| logSw: | -5.3553 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.171 |
| InChI Key: | HRVGUILKNFBZPY-UHFFFAOYSA-N |