N-(2,3-dimethylphenyl)-2-{[3-(4-methylpiperidin-1-yl)quinoxalin-2-yl]sulfanyl}acetamide
Chemical Structure Depiction of
N-(2,3-dimethylphenyl)-2-{[3-(4-methylpiperidin-1-yl)quinoxalin-2-yl]sulfanyl}acetamide
N-(2,3-dimethylphenyl)-2-{[3-(4-methylpiperidin-1-yl)quinoxalin-2-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | 7472-0113 |
| Compound Name: | N-(2,3-dimethylphenyl)-2-{[3-(4-methylpiperidin-1-yl)quinoxalin-2-yl]sulfanyl}acetamide |
| Molecular Weight: | 420.58 |
| Molecular Formula: | C24 H28 N4 O S |
| Smiles: | CC1CCN(CC1)c1c(nc2ccccc2n1)SCC(Nc1cccc(C)c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 6.0524 |
| logD: | 6.0524 |
| logSw: | -5.471 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.868 |
| InChI Key: | UMIMDSVSGLDZLN-UHFFFAOYSA-N |