2-{[3-(piperidin-1-yl)quinoxalin-2-yl]sulfanyl}-N-[3-(trifluoromethyl)phenyl]acetamide
Chemical Structure Depiction of
2-{[3-(piperidin-1-yl)quinoxalin-2-yl]sulfanyl}-N-[3-(trifluoromethyl)phenyl]acetamide
2-{[3-(piperidin-1-yl)quinoxalin-2-yl]sulfanyl}-N-[3-(trifluoromethyl)phenyl]acetamide
Compound characteristics
| Compound ID: | 7472-0212 |
| Compound Name: | 2-{[3-(piperidin-1-yl)quinoxalin-2-yl]sulfanyl}-N-[3-(trifluoromethyl)phenyl]acetamide |
| Molecular Weight: | 446.49 |
| Molecular Formula: | C22 H21 F3 N4 O S |
| Smiles: | C1CCN(CC1)c1c(nc2ccccc2n1)SCC(Nc1cccc(c1)C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 6.1348 |
| logD: | 6.1342 |
| logSw: | -6.0349 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.566 |
| InChI Key: | OIENZTNQNLBSGJ-UHFFFAOYSA-N |