N-[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]-3,4-dichlorobenzamide
Chemical Structure Depiction of
N-[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]-3,4-dichlorobenzamide
N-[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]-3,4-dichlorobenzamide
Compound characteristics
| Compound ID: | 7523-2838 |
| Compound Name: | N-[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]-3,4-dichlorobenzamide |
| Molecular Weight: | 433.74 |
| Molecular Formula: | C20 H11 Cl3 N2 O S |
| Smiles: | c1ccc2c(c1)nc(c1ccc(cc1[Cl])NC(c1ccc(c(c1)[Cl])[Cl])=O)s2 |
| Stereo: | ACHIRAL |
| logP: | 7.0744 |
| logD: | 6.9612 |
| logSw: | -6.713 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.778 |
| InChI Key: | XVAJEDMGFIUGDX-UHFFFAOYSA-N |