2-[(4-fluorophenyl)methyl]-6-phenylimidazo[2,1-b][1,3]thiazole
Chemical Structure Depiction of
2-[(4-fluorophenyl)methyl]-6-phenylimidazo[2,1-b][1,3]thiazole
2-[(4-fluorophenyl)methyl]-6-phenylimidazo[2,1-b][1,3]thiazole
Compound characteristics
| Compound ID: | 7575-0010 |
| Compound Name: | 2-[(4-fluorophenyl)methyl]-6-phenylimidazo[2,1-b][1,3]thiazole |
| Molecular Weight: | 308.38 |
| Molecular Formula: | C18 H13 F N2 S |
| Smiles: | C(c1ccc(cc1)F)c1cn2cc(c3ccccc3)nc2s1 |
| Stereo: | ACHIRAL |
| logP: | 4.9843 |
| logD: | 4.983 |
| logSw: | -4.8511 |
| Hydrogen bond acceptors count: | 1 |
| Polar surface area: | 10.4799 |
| InChI Key: | IHNUNGPGKCVWFN-UHFFFAOYSA-N |