6-(4-fluorophenyl)-2-{[4-(propan-2-yl)phenyl]methyl}imidazo[2,1-b][1,3]thiazole
Chemical Structure Depiction of
6-(4-fluorophenyl)-2-{[4-(propan-2-yl)phenyl]methyl}imidazo[2,1-b][1,3]thiazole
6-(4-fluorophenyl)-2-{[4-(propan-2-yl)phenyl]methyl}imidazo[2,1-b][1,3]thiazole
Compound characteristics
| Compound ID: | 7575-0037 |
| Compound Name: | 6-(4-fluorophenyl)-2-{[4-(propan-2-yl)phenyl]methyl}imidazo[2,1-b][1,3]thiazole |
| Molecular Weight: | 350.46 |
| Molecular Formula: | C21 H19 F N2 S |
| Smiles: | CC(C)c1ccc(Cc2cn3cc(c4ccc(cc4)F)nc3s2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 6.4276 |
| logD: | 6.4272 |
| logSw: | -5.914 |
| Hydrogen bond acceptors count: | 1 |
| Polar surface area: | 10.4799 |
| InChI Key: | DWGISMGGDKSOTI-UHFFFAOYSA-N |