2-[(2,4-dichlorophenyl)methyl]-6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazole
Chemical Structure Depiction of
2-[(2,4-dichlorophenyl)methyl]-6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazole
2-[(2,4-dichlorophenyl)methyl]-6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazole
Compound characteristics
| Compound ID: | 7575-0046 |
| Compound Name: | 2-[(2,4-dichlorophenyl)methyl]-6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazole |
| Molecular Weight: | 377.27 |
| Molecular Formula: | C18 H11 Cl2 F N2 S |
| Smiles: | C(c1ccc(cc1[Cl])[Cl])c1cn2cc(c3ccc(cc3)F)nc2s1 |
| Stereo: | ACHIRAL |
| logP: | 6.5886 |
| logD: | 6.5881 |
| logSw: | -6.7148 |
| Hydrogen bond acceptors count: | 1 |
| Polar surface area: | 10.4799 |
| InChI Key: | NUMQPRVLLUMPOV-UHFFFAOYSA-N |