1,4-bis(3-butoxyphenyl)piperazine-2,5-dione
Chemical Structure Depiction of
1,4-bis(3-butoxyphenyl)piperazine-2,5-dione
1,4-bis(3-butoxyphenyl)piperazine-2,5-dione
Compound characteristics
| Compound ID: | 7589-0046 |
| Compound Name: | 1,4-bis(3-butoxyphenyl)piperazine-2,5-dione |
| Molecular Weight: | 410.51 |
| Molecular Formula: | C24 H30 N2 O4 |
| Smiles: | CCCCOc1cccc(c1)N1CC(N(CC1=O)c1cccc(c1)OCCCC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9441 |
| logD: | 4.9441 |
| logSw: | -4.5682 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 47.65 |
| InChI Key: | QRDNMVFWCPCXHE-UHFFFAOYSA-N |