N-[1-(3,4-dimethylphenyl)-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]-3,4,5-trimethoxybenzamide
Chemical Structure Depiction of
N-[1-(3,4-dimethylphenyl)-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]-3,4,5-trimethoxybenzamide
N-[1-(3,4-dimethylphenyl)-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]-3,4,5-trimethoxybenzamide
Compound characteristics
| Compound ID: | 7591-0626 |
| Compound Name: | N-[1-(3,4-dimethylphenyl)-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]-3,4,5-trimethoxybenzamide |
| Molecular Weight: | 560.57 |
| Molecular Formula: | C29 H31 F3 N2 O6 |
| Smiles: | Cc1ccc(cc1C)N1C2CC(C)(C)CC(C=2C(C1=O)(C(F)(F)F)NC(c1cc(c(c(c1)OC)OC)OC)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.8299 |
| logD: | 0.6885 |
| logSw: | -4.6688 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 76.689 |
| InChI Key: | BOBMWIWKXWBDMO-NDEPHWFRSA-N |