N-[1-(4-chlorophenyl)-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]cyclohexanecarboxamide
Chemical Structure Depiction of
N-[1-(4-chlorophenyl)-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]cyclohexanecarboxamide
N-[1-(4-chlorophenyl)-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]cyclohexanecarboxamide
Compound characteristics
| Compound ID: | 7591-0777 |
| Compound Name: | N-[1-(4-chlorophenyl)-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]cyclohexanecarboxamide |
| Molecular Weight: | 482.93 |
| Molecular Formula: | C24 H26 Cl F3 N2 O3 |
| Smiles: | CC1(C)CC2=C(C(C1)=O)C(C(N2c1ccc(cc1)[Cl])=O)(C(F)(F)F)NC(C1CCCCC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7221 |
| logD: | -0.0736 |
| logSw: | -4.8 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.903 |
| InChI Key: | LBPICSJXGBCVQA-QHCPKHFHSA-N |