6-(4-nitrophenyl)-2,3-diphenylimidazo[2,1-b][1,3]thiazole
Chemical Structure Depiction of
6-(4-nitrophenyl)-2,3-diphenylimidazo[2,1-b][1,3]thiazole
6-(4-nitrophenyl)-2,3-diphenylimidazo[2,1-b][1,3]thiazole
Compound characteristics
| Compound ID: | 7624-0073 |
| Compound Name: | 6-(4-nitrophenyl)-2,3-diphenylimidazo[2,1-b][1,3]thiazole |
| Molecular Weight: | 397.45 |
| Molecular Formula: | C23 H15 N3 O2 S |
| Smiles: | c1ccc(cc1)c1c(c2ccccc2)sc2nc(cn12)c1ccc(cc1)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 6.2959 |
| logD: | 6.2894 |
| logSw: | -6.2094 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 41.31 |
| InChI Key: | LNLBEGUXRUEMSP-UHFFFAOYSA-N |