N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-5-(3-nitrophenyl)furan-2-carboxamide
Chemical Structure Depiction of
N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-5-(3-nitrophenyl)furan-2-carboxamide
N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-5-(3-nitrophenyl)furan-2-carboxamide
Compound characteristics
| Compound ID: | 7645-1568 |
| Compound Name: | N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-5-(3-nitrophenyl)furan-2-carboxamide |
| Molecular Weight: | 453.45 |
| Molecular Formula: | C26 H19 N3 O5 |
| Smiles: | CCc1ccc2c(c1)nc(c1cccc(c1)NC(c1ccc(c3cccc(c3)[N+]([O-])=O)o1)=O)o2 |
| Stereo: | ACHIRAL |
| logP: | 6.5692 |
| logD: | 6.5692 |
| logSw: | -5.6467 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.921 |
| InChI Key: | VEVYSYKYFNOSTB-UHFFFAOYSA-N |