2-phenyl-5-(pyridin-4-yl)-3H-1,3,4-benzotriazepine
Chemical Structure Depiction of
2-phenyl-5-(pyridin-4-yl)-3H-1,3,4-benzotriazepine
2-phenyl-5-(pyridin-4-yl)-3H-1,3,4-benzotriazepine
Compound characteristics
| Compound ID: | 7652-0062 |
| Compound Name: | 2-phenyl-5-(pyridin-4-yl)-3H-1,3,4-benzotriazepine |
| Molecular Weight: | 298.35 |
| Molecular Formula: | C19 H14 N4 |
| Smiles: | c1ccc(cc1)C1NN=C(c2ccncc2)c2ccccc2N=1 |
| Stereo: | ACHIRAL |
| logP: | 3.1857 |
| logD: | 2.6521 |
| logSw: | -3.5841 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.37 |
| InChI Key: | QDBQZHXEXPFLBZ-UHFFFAOYSA-N |