N-[4-({[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetyl)phenyl]acetamide
Chemical Structure Depiction of
N-[4-({[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetyl)phenyl]acetamide
N-[4-({[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetyl)phenyl]acetamide
Compound characteristics
| Compound ID: | 7653-2922 |
| Compound Name: | N-[4-({[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetyl)phenyl]acetamide |
| Molecular Weight: | 413.45 |
| Molecular Formula: | C20 H19 N3 O5 S |
| Smiles: | CC(Nc1ccc(cc1)C(CSc1nnc(c2ccc(c(c2)OC)OC)o1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9523 |
| logD: | 1.9522 |
| logSw: | -2.7152 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.834 |
| InChI Key: | ZIRGJZWXUYLNQH-UHFFFAOYSA-N |