1-(4-chlorophenoxy)-3-[2-(hydroxymethyl)-1H-benzimidazol-1-yl]propan-2-ol
Chemical Structure Depiction of
1-(4-chlorophenoxy)-3-[2-(hydroxymethyl)-1H-benzimidazol-1-yl]propan-2-ol
1-(4-chlorophenoxy)-3-[2-(hydroxymethyl)-1H-benzimidazol-1-yl]propan-2-ol
Compound characteristics
| Compound ID: | 7661-0037 |
| Compound Name: | 1-(4-chlorophenoxy)-3-[2-(hydroxymethyl)-1H-benzimidazol-1-yl]propan-2-ol |
| Molecular Weight: | 332.78 |
| Molecular Formula: | C17 H17 Cl N2 O3 |
| Smiles: | C(C(COc1ccc(cc1)[Cl])O)n1c2ccccc2nc1CO |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.1404 |
| logD: | 3.1403 |
| logSw: | -3.1562 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.377 |
| InChI Key: | QGNOLFMCZYEVSI-ZDUSSCGKSA-N |