N-(3-chloro-2-methylphenyl)-N~2~-(dimethylsulfamoyl)-N~2~-phenylglycinamide
Chemical Structure Depiction of
N-(3-chloro-2-methylphenyl)-N~2~-(dimethylsulfamoyl)-N~2~-phenylglycinamide
N-(3-chloro-2-methylphenyl)-N~2~-(dimethylsulfamoyl)-N~2~-phenylglycinamide
Compound characteristics
| Compound ID: | 7680-1570 |
| Compound Name: | N-(3-chloro-2-methylphenyl)-N~2~-(dimethylsulfamoyl)-N~2~-phenylglycinamide |
| Molecular Weight: | 381.88 |
| Molecular Formula: | C17 H20 Cl N3 O3 S |
| Smiles: | Cc1c(cccc1[Cl])NC(CN(c1ccccc1)S(N(C)C)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.047 |
| logD: | 3.0468 |
| logSw: | -3.394 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.602 |
| InChI Key: | TVFWRVWJKWKUGK-UHFFFAOYSA-N |