N~2~-(dimethylsulfamoyl)-N~2~-phenyl-N-[2-(phenylsulfanyl)phenyl]glycinamide
Chemical Structure Depiction of
N~2~-(dimethylsulfamoyl)-N~2~-phenyl-N-[2-(phenylsulfanyl)phenyl]glycinamide
N~2~-(dimethylsulfamoyl)-N~2~-phenyl-N-[2-(phenylsulfanyl)phenyl]glycinamide
Compound characteristics
| Compound ID: | 7684-2093 |
| Compound Name: | N~2~-(dimethylsulfamoyl)-N~2~-phenyl-N-[2-(phenylsulfanyl)phenyl]glycinamide |
| Molecular Weight: | 441.57 |
| Molecular Formula: | C22 H23 N3 O3 S2 |
| Smiles: | CN(C)S(N(CC(Nc1ccccc1Sc1ccccc1)=O)c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.778 |
| logD: | 3.778 |
| logSw: | -3.9174 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.331 |
| InChI Key: | BZTVGLYTXDAORW-UHFFFAOYSA-N |