N-(2-{[(2,4-dichlorophenyl)methyl]sulfanyl}ethyl)-N~2~-(dimethylsulfamoyl)-N~2~-phenylglycinamide
Chemical Structure Depiction of
N-(2-{[(2,4-dichlorophenyl)methyl]sulfanyl}ethyl)-N~2~-(dimethylsulfamoyl)-N~2~-phenylglycinamide
N-(2-{[(2,4-dichlorophenyl)methyl]sulfanyl}ethyl)-N~2~-(dimethylsulfamoyl)-N~2~-phenylglycinamide
Compound characteristics
| Compound ID: | 7684-2611 |
| Compound Name: | N-(2-{[(2,4-dichlorophenyl)methyl]sulfanyl}ethyl)-N~2~-(dimethylsulfamoyl)-N~2~-phenylglycinamide |
| Molecular Weight: | 476.44 |
| Molecular Formula: | C19 H23 Cl2 N3 O3 S2 |
| Smiles: | CN(C)S(N(CC(NCCSCc1ccc(cc1[Cl])[Cl])=O)c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6833 |
| logD: | 3.6833 |
| logSw: | -3.9671 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.464 |
| InChI Key: | RWEJBBRSKAUHSJ-UHFFFAOYSA-N |