N-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-N',N'-dimethyl-N-phenylsulfuric diamide
Chemical Structure Depiction of
N-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-N',N'-dimethyl-N-phenylsulfuric diamide
N-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-N',N'-dimethyl-N-phenylsulfuric diamide
Compound characteristics
| Compound ID: | 7684-5397 |
| Compound Name: | N-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-N',N'-dimethyl-N-phenylsulfuric diamide |
| Molecular Weight: | 415.55 |
| Molecular Formula: | C22 H29 N3 O3 S |
| Smiles: | CN(C)S(N(CC(N1CCC(CC1)Cc1ccccc1)=O)c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1602 |
| logD: | 3.1602 |
| logSw: | -3.3749 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 52.272 |
| InChI Key: | UCDGFAPTBNKJGD-UHFFFAOYSA-N |