methyl 2-amino-4-(2,5-dimethoxyphenyl)-7-methyl-5-oxo-5,6-dihydro-4H-pyrano[3,2-c]pyridine-3-carboxylate
Chemical Structure Depiction of
methyl 2-amino-4-(2,5-dimethoxyphenyl)-7-methyl-5-oxo-5,6-dihydro-4H-pyrano[3,2-c]pyridine-3-carboxylate
methyl 2-amino-4-(2,5-dimethoxyphenyl)-7-methyl-5-oxo-5,6-dihydro-4H-pyrano[3,2-c]pyridine-3-carboxylate
Compound characteristics
| Compound ID: | 7706-1155 |
| Compound Name: | methyl 2-amino-4-(2,5-dimethoxyphenyl)-7-methyl-5-oxo-5,6-dihydro-4H-pyrano[3,2-c]pyridine-3-carboxylate |
| Molecular Weight: | 372.38 |
| Molecular Formula: | C19 H20 N2 O6 |
| Smiles: | CC1=CC2=C(C(C(=C(N)O2)C(=O)OC)c2cc(ccc2OC)OC)C(N1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.7296 |
| logD: | 1.7273 |
| logSw: | -2.2299 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 90.187 |
| InChI Key: | QMYZESAKBWMZIA-CQSZACIVSA-N |