1-(4-fluorophenyl)-2-(5-methyl-2-oxopyridin-1(2H)-yl)-3-[4-(3-phenylprop-2-en-1-yl)piperazin-1-yl]propane-1,3-dione
Chemical Structure Depiction of
1-(4-fluorophenyl)-2-(5-methyl-2-oxopyridin-1(2H)-yl)-3-[4-(3-phenylprop-2-en-1-yl)piperazin-1-yl]propane-1,3-dione
1-(4-fluorophenyl)-2-(5-methyl-2-oxopyridin-1(2H)-yl)-3-[4-(3-phenylprop-2-en-1-yl)piperazin-1-yl]propane-1,3-dione
Compound characteristics
| Compound ID: | 7756-0438 |
| Compound Name: | 1-(4-fluorophenyl)-2-(5-methyl-2-oxopyridin-1(2H)-yl)-3-[4-(3-phenylprop-2-en-1-yl)piperazin-1-yl]propane-1,3-dione |
| Molecular Weight: | 473.55 |
| Molecular Formula: | C28 H28 F N3 O3 |
| Smiles: | CC1C=CC(N(C=1)C(C(c1ccc(cc1)F)=O)C(N1CCN(CC1)C/C=C/c1ccccc1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3277 |
| logD: | 3.3252 |
| logSw: | -3.3715 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 49.782 |
| InChI Key: | KKBPDCQHLJRYPG-SANMLTNESA-N |