5'-chloro-3'-hydroxy-1'-[(4-methylphenyl)methyl]-1',3'-dihydro-1H,2'H-[3,3'-biindol]-2'-one
Chemical Structure Depiction of
5'-chloro-3'-hydroxy-1'-[(4-methylphenyl)methyl]-1',3'-dihydro-1H,2'H-[3,3'-biindol]-2'-one
5'-chloro-3'-hydroxy-1'-[(4-methylphenyl)methyl]-1',3'-dihydro-1H,2'H-[3,3'-biindol]-2'-one
Compound characteristics
| Compound ID: | 7775-0072 |
| Compound Name: | 5'-chloro-3'-hydroxy-1'-[(4-methylphenyl)methyl]-1',3'-dihydro-1H,2'H-[3,3'-biindol]-2'-one |
| Molecular Weight: | 402.88 |
| Molecular Formula: | C24 H19 Cl N2 O2 |
| Smiles: | Cc1ccc(CN2C(C(c3cc(ccc23)[Cl])(c2c[nH]c3ccccc23)O)=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.5231 |
| logD: | 5.5231 |
| logSw: | -5.5952 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 40.199 |
| InChI Key: | HEZHRKTUWLDQLK-XMMPIXPASA-N |