3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)prop-2-enamide
Chemical Structure Depiction of
3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)prop-2-enamide
3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)prop-2-enamide
Compound characteristics
| Compound ID: | 7833-1742 |
| Compound Name: | 3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)prop-2-enamide |
| Molecular Weight: | 430.31 |
| Molecular Formula: | C20 H13 Cl2 N3 O2 S |
| Smiles: | Cc1ccc2c(c1NC(/C=C/c1ccc(c3ccc(cc3[Cl])[Cl])o1)=O)nsn2 |
| Stereo: | ACHIRAL |
| logP: | 6.2251 |
| logD: | 6.2247 |
| logSw: | -6.1966 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.243 |
| InChI Key: | OEWQNUDFMDYLDR-UHFFFAOYSA-N |