3-ethoxy-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)benzamide
Chemical Structure Depiction of
3-ethoxy-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)benzamide
3-ethoxy-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)benzamide
Compound characteristics
| Compound ID: | 7833-1751 |
| Compound Name: | 3-ethoxy-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)benzamide |
| Molecular Weight: | 313.38 |
| Molecular Formula: | C16 H15 N3 O2 S |
| Smiles: | CCOc1cccc(c1)C(Nc1c(C)ccc2c1nsn2)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4403 |
| logD: | 3.4377 |
| logSw: | -3.6473 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.01 |
| InChI Key: | MZGVEBUFWMTHPR-UHFFFAOYSA-N |