N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(5-phenylfuran-2-yl)prop-2-enamide
Chemical Structure Depiction of
N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(5-phenylfuran-2-yl)prop-2-enamide
N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(5-phenylfuran-2-yl)prop-2-enamide
Compound characteristics
| Compound ID: | 7833-1956 |
| Compound Name: | N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(5-phenylfuran-2-yl)prop-2-enamide |
| Molecular Weight: | 420.47 |
| Molecular Formula: | C27 H20 N2 O3 |
| Smiles: | Cc1ccc2c(c1)nc(c1cccc(c1)NC(/C=C/c1ccc(c3ccccc3)o1)=O)o2 |
| Stereo: | ACHIRAL |
| logP: | 6.717 |
| logD: | 6.7169 |
| logSw: | -5.7138 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.496 |
| InChI Key: | UJAOLNKMOZJBRD-UHFFFAOYSA-N |