N-[4-chloro-3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-3-(5-phenylfuran-2-yl)prop-2-enamide
Chemical Structure Depiction of
N-[4-chloro-3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-3-(5-phenylfuran-2-yl)prop-2-enamide
N-[4-chloro-3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-3-(5-phenylfuran-2-yl)prop-2-enamide
Compound characteristics
| Compound ID: | 7833-2698 |
| Compound Name: | N-[4-chloro-3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-3-(5-phenylfuran-2-yl)prop-2-enamide |
| Molecular Weight: | 475.33 |
| Molecular Formula: | C26 H16 Cl2 N2 O3 |
| Smiles: | C(=C/c1ccc(c2ccccc2)o1)\C(Nc1ccc(c(c1)c1nc2cc(ccc2o1)[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 7.4448 |
| logD: | 7.4447 |
| logSw: | -6.6626 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.496 |
| InChI Key: | PCLUGHXYKXEQGE-UHFFFAOYSA-N |